C20H21ClN2O2 — CID 108948145
N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropanamide (PubChem CID 108948145) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108948145 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropanamide |
| SMILES | Cc1cc(C)c(NC(=O)CC(=O)N2CCc3ccccc3C2)c(Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-13-9-14(2)20(17(21)10-13)22-18(24)11-19(25)23-8-7-15-5-3-4-6-16(15)12-23/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,22,24) |
| InChIKey | YYDWNZWFVSPUJR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|