C18H22INO2 — CID 10894873
methyl (1R,2S,3S,5S)-3-[4-[(E)-2-iodoethenyl]phenyl]-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10894873) has the molecular formula C18H22INO2 and a molecular weight of 411.28 g/mol. Its IUPAC name is methyl (1R,2S,3S,5S)-3-[4-[(E)-2-iodoethenyl]phenyl]-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,5S)-3-[4-[(E)-2-iodoethenyl]phenyl]-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10894873 |
| Molecular Formula | C18H22INO2 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | methyl (1R,2S,3S,5S)-3-[4-[(E)-2-iodoethenyl]phenyl]-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccc(/C=C/I)cc2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C18H22INO2/c1-20-14-7-8-16(20)17(18(21)22-2)15(11-14)13-5-3-12(4-6-13)9-10-19/h3-6,9-10,14-17H,7-8,11H2,1-2H3/b10-9+/t14-,15+,16+,17-/m0/s1 |
| InChIKey | ABXUYGWOEIXKBD-CRPCGCOQSA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|