C18H25N3O5S — CID 108949040
N-(1,1-dioxothiolan-3-yl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide (PubChem CID 108949040) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 108949040 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide |
| SMILES | COc1ccccc1N1CCN(C(=O)CC(=O)NC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C18H25N3O5S/c1-26-16-5-3-2-4-15(16)20-7-9-21(10-8-20)18(23)12-17(22)19-14-6-11-27(24,25)13-14/h2-5,14H,6-13H2,1H3,(H,19,22) |
| InChIKey | PTALDQROXLVDSF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|