C19H26N2O6 — CID 108949993
3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-[2-(4-methoxyphenoxy)ethyl]-3-oxopropanamide (PubChem CID 108949993) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-[2-(4-methoxyphenoxy)ethyl]-3-oxopropanamide.
| Compound Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-[2-(4-methoxyphenoxy)ethyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 108949993 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-[2-(4-methoxyphenoxy)ethyl]-3-oxopropanamide |
| SMILES | COc1ccc(OCCNC(=O)CC(=O)N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C19H26N2O6/c1-24-15-2-4-16(5-3-15)25-11-8-20-17(22)14-18(23)21-9-6-19(7-10-21)26-12-13-27-19/h2-5H,6-14H2,1H3,(H,20,22) |
| InChIKey | LKRWRWFAPDMDJI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|