C16H26N2O4 — CID 108950002
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione (PubChem CID 108950002) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108950002 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(3-methylpiperidin-1-yl)propane-1,3-dione |
| SMILES | CC1CCCN(C(=O)CC(=O)N2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C16H26N2O4/c1-13-3-2-6-18(12-13)15(20)11-14(19)17-7-4-16(5-8-17)21-9-10-22-16/h13H,2-12H2,1H3 |
| InChIKey | LZRXATZJKCPWNA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|