C27H30FNO2 — CID 10895056
(3R,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-ol (PubChem CID 10895056) has the molecular formula C27H30FNO2 and a molecular weight of 419.54 g/mol. Its IUPAC name is (3R,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-ol.
| Compound Name | (3R,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 10895056 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (3R,4S)-4-(2-benzhydryloxyethyl)-1-[(4-fluorophenyl)methyl]piperidin-3-ol |
| SMILES | O[C@H]1CN(Cc2ccc(F)cc2)CC[C@H]1CCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30FNO2/c28-25-13-11-21(12-14-25)19-29-17-15-22(26(30)20-29)16-18-31-27(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-14,22,26-27,30H,15-20H2/t22-,26-/m0/s1 |
| InChIKey | SEGLRXUOVKIQDG-NVQXNPDNSA-N |
| XLogP | 5.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |