C16H20Cl2N2O2 — CID 108951648
N-cycloheptyl-N'-(3,5-dichlorophenyl)propanediamide (PubChem CID 108951648) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is N-cycloheptyl-N'-(3,5-dichlorophenyl)propanediamide.
| Compound Name | N-cycloheptyl-N'-(3,5-dichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 108951648 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-cycloheptyl-N'-(3,5-dichlorophenyl)propanediamide |
| SMILES | O=C(CC(=O)NC1CCCCCC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c17-11-7-12(18)9-14(8-11)20-16(22)10-15(21)19-13-5-3-1-2-4-6-13/h7-9,13H,1-6,10H2,(H,19,21)(H,20,22) |
| InChIKey | WGJDDSLFWYOQEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|