C24H48O2Si2 — CID 10895168
[(E,1R,2S,3R,4R)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-3-trimethylsilyloxyoct-5-en-7-ynoxy]-tert-butyl-dimethylsilane (PubChem CID 10895168) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is [(E,1R,2S,3R,4R)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-3-trimethylsilyloxyoct-5-en-7-ynoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,1R,2S,3R,4R)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-3-trimethylsilyloxyoct-5-en-7-ynoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10895168 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | [(E,1R,2S,3R,4R)-1-[(2S)-butan-2-yl]-2,4,6-trimethyl-3-trimethylsilyloxyoct-5-en-7-ynoxy]-tert-butyl-dimethylsilane |
| SMILES | C#C/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C24H48O2Si2/c1-15-18(3)17-20(5)23(25-27(10,11)12)21(6)22(19(4)16-2)26-28(13,14)24(7,8)9/h1,17,19-23H,16H2,2-14H3/b18-17+/t19-,20+,21-,22+,23+/m0/s1 |
| InChIKey | RFSIZKGDPNQWQD-IOYGALHKSA-N |
| XLogP | 7.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|