C15H19F3N2O2 — CID 108951939
N-pentyl-N'-[2-(trifluoromethyl)phenyl]propanediamide (PubChem CID 108951939) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is N-pentyl-N'-[2-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-pentyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 108951939 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-pentyl-N'-[2-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCCCCNC(=O)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O2/c1-2-3-6-9-19-13(21)10-14(22)20-12-8-5-4-7-11(12)15(16,17)18/h4-5,7-8H,2-3,6,9-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | UBEAZBKDWMKBEM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|