C15H18INO4S — CID 10895379
methyl 5-ethyl-4-iodo-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole-2-carboxylate (PubChem CID 10895379) has the molecular formula C15H18INO4S and a molecular weight of 435.28 g/mol. Its IUPAC name is methyl 5-ethyl-4-iodo-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole-2-carboxylate.
| Compound Name | methyl 5-ethyl-4-iodo-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10895379 |
| Molecular Formula | C15H18INO4S |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | methyl 5-ethyl-4-iodo-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole-2-carboxylate |
| SMILES | CCC1=C(I)CC(C(=O)OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18INO4S/c1-4-13-12(16)9-14(15(18)21-3)17(13)22(19,20)11-7-5-10(2)6-8-11/h5-8,14H,4,9H2,1-3H3 |
| InChIKey | JLMFUQRFENDPJQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|