About N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide
N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide (PubChem CID 108954138) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide.
Molecular Properties
| Compound Name | N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide |
| PubChem CID | 108954138 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(=O)N(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-4-23(5-2)18-14-12-17(13-15-18)22-20(25)16-21(26)24(6-3)19-10-8-7-9-11-19/h7-15H,4-6,16H2,1-3H3,(H,22,25) |
| InChIKey | RWKYJRHHSXKHCO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide?
The IUPAC name of N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide (CID 108954138) is N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide.
What is the SMILES notation for N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide?
The canonical SMILES for N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide is CCN(CC)c1ccc(NC(=O)CC(=O)N(CC)c2ccccc2)cc1.
What is the InChIKey of N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide?
The InChIKey is RWKYJRHHSXKHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c1-4-23(5-2)18-14-12-17(13-15-18)22-20(25)16-21(26)24(6-3)19-10-8-7-9-11-19/h7-15H,4-6,16H2,1-3H3,(H,22,25).
What are the key properties of N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide?
N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide has a molecular weight of 353.47 g/mol, XLogP of 3.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(diethylamino)phenyl]-N'-ethyl-N'-phenylpropanediamide is sourced from PubChem (CID 108954138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).