C25H30N2O5 — CID 10895444
4-(3,4-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 10895444) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10895444 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-[(3,5-dimethoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1cc(CN2N=C(c3ccc(OC)c(OC)c3)C3CCCCC3C2=O)cc(OC)c1 |
| InChI | InChI=1S/C25H30N2O5/c1-29-18-11-16(12-19(14-18)30-2)15-27-25(28)21-8-6-5-7-20(21)24(26-27)17-9-10-22(31-3)23(13-17)32-4/h9-14,20-21H,5-8,15H2,1-4H3 |
| InChIKey | WDMINEFVSXLMJR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |