C25H28O2Se — CID 10895461
[4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenyl] acetate (PubChem CID 10895461) has the molecular formula C25H28O2Se and a molecular weight of 439.46 g/mol. Its IUPAC name is [4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenyl] acetate.
| Compound Name | [4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenyl] acetate |
|---|---|
| PubChem CID | 10895461 |
| Molecular Formula | C25H28O2Se |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [4-[2-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C#C[Se]c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C25H28O2Se/c1-17-15-21-22(25(5,6)13-12-24(21,3)4)16-23(17)28-14-11-19-7-9-20(10-8-19)27-18(2)26/h7-10,15-16H,12-13H2,1-6H3 |
| InChIKey | NRYSAHQHDPWRFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|