C26H40O6 — CID 10895618
2-[(2R,4Z)-4-[(5S)-5-methyl-5-[(4R)-4-methyltetradecyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid (PubChem CID 10895618) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 2-[(2R,4Z)-4-[(5S)-5-methyl-5-[(4R)-4-methyltetradecyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid.
| Compound Name | 2-[(2R,4Z)-4-[(5S)-5-methyl-5-[(4R)-4-methyltetradecyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 10895618 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-[(2R,4Z)-4-[(5S)-5-methyl-5-[(4R)-4-methyltetradecyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetic acid |
| SMILES | CCCCCCCCCC[C@@H](C)CCC[C@@]1(C)C=C/C(=C2/C(=O)O[C@H](CC(=O)O)C2=O)O1 |
| InChI | InChI=1S/C26H40O6/c1-4-5-6-7-8-9-10-11-13-19(2)14-12-16-26(3)17-15-20(32-26)23-24(29)21(18-22(27)28)31-25(23)30/h15,17,19,21H,4-14,16,18H2,1-3H3,(H,27,28)/b23-20-/t19-,21-,26+/m1/s1 |
| InChIKey | GTHQWTZYJQZCCN-FWIBNMFGSA-N |
| XLogP | 5.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|