C23H28N2O4 — CID 108956307
methyl 2-[[3-[2,6-di(propan-2-yl)anilino]-3-oxopropanoyl]amino]benzoate (PubChem CID 108956307) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[[3-[2,6-di(propan-2-yl)anilino]-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 2-[[3-[2,6-di(propan-2-yl)anilino]-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108956307 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 2-[[3-[2,6-di(propan-2-yl)anilino]-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H28N2O4/c1-14(2)16-10-8-11-17(15(3)4)22(16)25-21(27)13-20(26)24-19-12-7-6-9-18(19)23(28)29-5/h6-12,14-15H,13H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | FVVBCUIPZTZDSK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|