C21H21N3O5 — CID 108956737
N-quinolin-8-yl-N'-(3,4,5-trimethoxyphenyl)propanediamide (PubChem CID 108956737) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-quinolin-8-yl-N'-(3,4,5-trimethoxyphenyl)propanediamide.
| Compound Name | N-quinolin-8-yl-N'-(3,4,5-trimethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108956737 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-quinolin-8-yl-N'-(3,4,5-trimethoxyphenyl)propanediamide |
| SMILES | COc1cc(NC(=O)CC(=O)Nc2cccc3cccnc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N3O5/c1-27-16-10-14(11-17(28-2)21(16)29-3)23-18(25)12-19(26)24-15-8-4-6-13-7-5-9-22-20(13)15/h4-11H,12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | RCBQITGWKRXOPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|