C22H23ClN6O3 — CID 10895707
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-hydroxyethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide (PubChem CID 10895707) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-hydroxyethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-hydroxyethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 10895707 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-hydroxyethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NCCO)c2=O)cc1 |
| InChI | InChI=1S/C22H23ClN6O3/c23-19-18(15-4-2-1-3-5-15)29(22(32)21(28-19)26-10-11-30)13-17(31)27-12-14-6-8-16(9-7-14)20(24)25/h1-9,30H,10-13H2,(H3,24,25)(H,26,28)(H,27,31) |
| InChIKey | VJGJLSAOJICPME-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|