About carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one
carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one (PubChem CID 10895801) has the molecular formula C17H10Co2O8
and a molecular weight of 460.13 g/mol. Its IUPAC name is carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one.
Molecular Properties
| Compound Name | carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one |
| PubChem CID | 10895801 |
| Molecular Formula | C17H10Co2O8 |
| Molecular Weight | 460.13 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one |
| SMILES | C=CC(=O)C#CCCc1ccco1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C11H10O2.6CO.2Co/c1-2-10(12)6-3-4-7-11-8-5-9-13-11;6*1-2;;/h2,5,8-9H,1,4,7H2;;;;;;;; |
| InChIKey | BLWUNGAZGVKURA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 149.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one?
The IUPAC name of carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one (CID 10895801) is carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one.
What is the SMILES notation for carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one?
The canonical SMILES for carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one is C=CC(=O)C#CCCc1ccco1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co].
What is the InChIKey of carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one?
The InChIKey is BLWUNGAZGVKURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.6CO.2Co/c1-2-10(12)6-3-4-7-11-8-5-9-13-11;6*1-2;;/h2,5,8-9H,1,4,7H2;;;;;;;;.
What are the key properties of carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one?
carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one has a molecular weight of 460.13 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;7-(furan-2-yl)hept-1-en-4-yn-3-one is sourced from PubChem (CID 10895801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).