C17H24N2O2 — CID 108958363
2,2-dimethyl-N-[(3-methylphenyl)methyl]-3-oxo-3-pyrrolidin-1-ylpropanamide (PubChem CID 108958363) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(3-methylphenyl)methyl]-3-oxo-3-pyrrolidin-1-ylpropanamide.
| Compound Name | 2,2-dimethyl-N-[(3-methylphenyl)methyl]-3-oxo-3-pyrrolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 108958363 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2,2-dimethyl-N-[(3-methylphenyl)methyl]-3-oxo-3-pyrrolidin-1-ylpropanamide |
| SMILES | Cc1cccc(CNC(=O)C(C)(C)C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-13-7-6-8-14(11-13)12-18-15(20)17(2,3)16(21)19-9-4-5-10-19/h6-8,11H,4-5,9-10,12H2,1-3H3,(H,18,20) |
| InChIKey | CWCRGLMEFZDMIE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|