C32H22N4 — CID 10895852
10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 10895852) has the molecular formula C32H22N4 and a molecular weight of 462.56 g/mol. Its IUPAC name is 10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10895852 |
| Molecular Formula | C32H22N4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | C1=Cc2nc1cc1nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c2-c2ccccc2)[nH]3)C=C1 |
| InChI | InChI=1S/C32H22N4/c1-3-7-21(8-4-1)31-27-15-11-23(33-27)19-25-13-17-29(35-25)32(22-9-5-2-6-10-22)30-18-14-26(36-30)20-24-12-16-28(31)34-24/h1-20,33,35H/b23-19-,24-20-,25-19-,26-20-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | QIBKIAFNCVIIMG-DUVOQLPESA-N |
| XLogP | 7.99 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |