C22H29BrO4S — CID 10895968
(1R,2S,3R,7S,11E,13S,15S)-3-(4-bromophenyl)sulfanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10895968) has the molecular formula C22H29BrO4S and a molecular weight of 469.44 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-3-(4-bromophenyl)sulfanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-3-(4-bromophenyl)sulfanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10895968 |
| Molecular Formula | C22H29BrO4S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-3-(4-bromophenyl)sulfanyl-2,15-dihydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)[C@H](Sc2ccc(Br)cc2)CC(=O)O1 |
| InChI | InChI=1S/C22H29BrO4S/c1-14-5-3-2-4-6-15-11-17(24)12-19(15)22(26)20(13-21(25)27-14)28-18-9-7-16(23)8-10-18/h4,6-10,14-15,17,19-20,22,24,26H,2-3,5,11-13H2,1H3/b6-4+/t14-,15+,17-,19+,20+,22-/m0/s1 |
| InChIKey | WXVIQDJXMAVIGD-BAJBADSPSA-N |
| XLogP | 4.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|