C34H40N2 — CID 10896074
(1S,2S)-1,2-diphenyl-N,N'-bis[(2,4,6-trimethylphenyl)methyl]ethane-1,2-diamine (PubChem CID 10896074) has the molecular formula C34H40N2 and a molecular weight of 476.71 g/mol. Its IUPAC name is (1S,2S)-1,2-diphenyl-N,N'-bis[(2,4,6-trimethylphenyl)methyl]ethane-1,2-diamine.
| Compound Name | (1S,2S)-1,2-diphenyl-N,N'-bis[(2,4,6-trimethylphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10896074 |
| Molecular Formula | C34H40N2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | (1S,2S)-1,2-diphenyl-N,N'-bis[(2,4,6-trimethylphenyl)methyl]ethane-1,2-diamine |
| SMILES | Cc1cc(C)c(CN[C@@H](c2ccccc2)[C@@H](NCc2c(C)cc(C)cc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C34H40N2/c1-23-17-25(3)31(26(4)18-23)21-35-33(29-13-9-7-10-14-29)34(30-15-11-8-12-16-30)36-22-32-27(5)19-24(2)20-28(32)6/h7-20,33-36H,21-22H2,1-6H3/t33-,34-/m0/s1 |
| InChIKey | NIAVGNITXGZNAA-HEVIKAOCSA-N |
| XLogP | 7.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |