C21H26N2O2 — CID 108961727
N-(3,5-dimethylphenyl)-2,2-dimethyl-N'-[(2-methylphenyl)methyl]propanediamide (PubChem CID 108961727) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2,2-dimethyl-N'-[(2-methylphenyl)methyl]propanediamide.
| Compound Name | N-(3,5-dimethylphenyl)-2,2-dimethyl-N'-[(2-methylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108961727 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2,2-dimethyl-N'-[(2-methylphenyl)methyl]propanediamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)(C)C(=O)NCc2ccccc2C)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-14-10-15(2)12-18(11-14)23-20(25)21(4,5)19(24)22-13-17-9-7-6-8-16(17)3/h6-12H,13H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | VCQPTQZJPDXIEB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|