C20H23FN2O4 — CID 108962476
N-(2,4-dimethoxyphenyl)-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide (PubChem CID 108962476) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108962476 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
| SMILES | COc1ccc(NC(=O)C(C)(C)C(=O)NCc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C20H23FN2O4/c1-20(2,18(24)22-12-13-7-5-6-8-15(13)21)19(25)23-16-10-9-14(26-3)11-17(16)27-4/h5-11H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | PLYGCQCKPFITII-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|