C21H25FN2O2 — CID 108962651
N-ethyl-N'-[(4-fluorophenyl)methyl]-2,2-dimethyl-N-(3-methylphenyl)propanediamide (PubChem CID 108962651) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-ethyl-N'-[(4-fluorophenyl)methyl]-2,2-dimethyl-N-(3-methylphenyl)propanediamide.
| Compound Name | N-ethyl-N'-[(4-fluorophenyl)methyl]-2,2-dimethyl-N-(3-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 108962651 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-ethyl-N'-[(4-fluorophenyl)methyl]-2,2-dimethyl-N-(3-methylphenyl)propanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)NCc1ccc(F)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C21H25FN2O2/c1-5-24(18-8-6-7-15(2)13-18)20(26)21(3,4)19(25)23-14-16-9-11-17(22)12-10-16/h6-13H,5,14H2,1-4H3,(H,23,25) |
| InChIKey | PWNJLYGARGSSOD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|