C17H25ClN2O2 — CID 108962687
N-butyl-N'-[(2-chlorophenyl)methyl]-N,2,2-trimethylpropanediamide (PubChem CID 108962687) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is N-butyl-N'-[(2-chlorophenyl)methyl]-N,2,2-trimethylpropanediamide.
| Compound Name | N-butyl-N'-[(2-chlorophenyl)methyl]-N,2,2-trimethylpropanediamide |
|---|---|
| PubChem CID | 108962687 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-butyl-N'-[(2-chlorophenyl)methyl]-N,2,2-trimethylpropanediamide |
| SMILES | CCCCN(C)C(=O)C(C)(C)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H25ClN2O2/c1-5-6-11-20(4)16(22)17(2,3)15(21)19-12-13-9-7-8-10-14(13)18/h7-10H,5-6,11-12H2,1-4H3,(H,19,21) |
| InChIKey | OMLFOCPDMRVNFL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|