C21H23ClN2O2 — CID 108962699
N-[(2-chlorophenyl)methyl]-3-(3,4-dihydro-2H-quinolin-1-yl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108962699) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(3,4-dihydro-2H-quinolin-1-yl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(3,4-dihydro-2H-quinolin-1-yl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108962699 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(3,4-dihydro-2H-quinolin-1-yl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)NCc1ccccc1Cl)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C21H23ClN2O2/c1-21(2,19(25)23-14-16-9-3-5-11-17(16)22)20(26)24-13-7-10-15-8-4-6-12-18(15)24/h3-6,8-9,11-12H,7,10,13-14H2,1-2H3,(H,23,25) |
| InChIKey | KBXGHZMNYXATKR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|