C21H16Cl2FN5O4 — CID 10896290
(E)-1-[2-[6-(2,3-dichlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine (PubChem CID 10896290) has the molecular formula C21H16Cl2FN5O4 and a molecular weight of 492.29 g/mol. Its IUPAC name is (E)-1-[2-[6-(2,3-dichlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine.
| Compound Name | (E)-1-[2-[6-(2,3-dichlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 10896290 |
| Molecular Formula | C21H16Cl2FN5O4 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | (E)-1-[2-[6-(2,3-dichlorophenoxy)-5-fluoropyrimidin-4-yl]oxyphenyl]-1-(5,6-dihydro-2H-1,2,4-oxadiazin-3-yl)-N-methoxymethanimine |
| SMILES | CO/N=C(/C1=NCCON1)c1ccccc1Oc1ncnc(Oc2cccc(Cl)c2Cl)c1F |
| InChI | InChI=1S/C21H16Cl2FN5O4/c1-30-28-18(19-25-9-10-31-29-19)12-5-2-3-7-14(12)32-20-17(24)21(27-11-26-20)33-15-8-4-6-13(22)16(15)23/h2-8,11H,9-10H2,1H3,(H,25,29)/b28-18+ |
| InChIKey | FFTYBQUJCWTLNP-MTDXEUNCSA-N |
| XLogP | 4.79 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|