C27H46O6Si — CID 10896315
ethyl (E,4S)-4-[(1R,3S,4S,5R)-1,4-dimethyl-6-oxo-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enoate (PubChem CID 10896315) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(1R,3S,4S,5R)-1,4-dimethyl-6-oxo-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(1R,3S,4S,5R)-1,4-dimethyl-6-oxo-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 10896315 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | ethyl (E,4S)-4-[(1R,3S,4S,5R)-1,4-dimethyl-6-oxo-8-[tri(propan-2-yl)silyloxymethyl]-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl]-2-methylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)[C@@H]1O[C@]2(C)O[C@@H](C(=O)C=C2CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C |
| InChI | InChI=1S/C27H46O6Si/c1-12-30-26(29)20(9)13-19(8)24-21(10)25-23(28)14-22(27(11,32-24)33-25)15-31-34(16(2)3,17(4)5)18(6)7/h13-14,16-19,21,24-25H,12,15H2,1-11H3/b20-13+/t19-,21-,24-,25+,27+/m0/s1 |
| InChIKey | VXDRIMBVIANGGA-YOFXDIOLSA-N |
| XLogP | 5.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|