C28H56O3Si2 — CID 10896336
(1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidenecyclopentan-1-ol (PubChem CID 10896336) has the molecular formula C28H56O3Si2 and a molecular weight of 496.93 g/mol. Its IUPAC name is (1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidenecyclopentan-1-ol.
| Compound Name | (1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 10896336 |
| Molecular Formula | C28H56O3Si2 |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | (1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@@H](/C=C/[C@H](C[C@@H](C)CCCC)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C28H56O3Si2/c1-14-15-16-21(2)19-23(30-32(10,11)27(4,5)6)17-18-24-22(3)25(29)20-26(24)31-33(12,13)28(7,8)9/h17-18,21,23-26,29H,3,14-16,19-20H2,1-2,4-13H3/b18-17+/t21-,23+,24+,25-,26+/m0/s1 |
| InChIKey | PRSBOBDGPLTSEC-QRPZKLJNSA-N |
| XLogP | 8.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|