C17H17Cl2N3O2 — CID 108963625
N-(3,4-dichlorophenyl)-2,2-dimethyl-N'-(pyridin-3-ylmethyl)propanediamide (PubChem CID 108963625) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,2-dimethyl-N'-(pyridin-3-ylmethyl)propanediamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,2-dimethyl-N'-(pyridin-3-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963625 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,2-dimethyl-N'-(pyridin-3-ylmethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCc1cccnc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-17(2,15(23)21-10-11-4-3-7-20-9-11)16(24)22-12-5-6-13(18)14(19)8-12/h3-9H,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BFTIYRYVKSIAJO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|