About [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate
[3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate (PubChem CID 10896395) has the molecular formula C30H34N2O5
and a molecular weight of 502.61 g/mol. Its IUPAC name is [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate |
| PubChem CID | 10896395 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(CN(C)CCCCCCCOc2ccc3c(=O)c4ccccc4oc3c2)c1 |
| InChI | InChI=1S/C30H34N2O5/c1-31-30(34)36-24-12-10-11-22(19-24)21-32(2)17-8-4-3-5-9-18-35-23-15-16-26-28(20-23)37-27-14-7-6-13-25(27)29(26)33/h6-7,10-16,19-20H,3-5,8-9,17-18,21H2,1-2H3,(H,31,34) |
| InChIKey | QKVHGMOFMMASRA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate?
The IUPAC name of [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate (CID 10896395) is [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate.
What is the SMILES notation for [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate?
The canonical SMILES for [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate is CNC(=O)Oc1cccc(CN(C)CCCCCCCOc2ccc3c(=O)c4ccccc4oc3c2)c1.
What is the InChIKey of [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate?
The InChIKey is QKVHGMOFMMASRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34N2O5/c1-31-30(34)36-24-12-10-11-22(19-24)21-32(2)17-8-4-3-5-9-18-35-23-15-16-26-28(20-23)37-27-14-7-6-13-25(27)29(26)33/h6-7,10-16,19-20H,3-5,8-9,17-18,21H2,1-2H3,(H,31,34).
What are the key properties of [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate?
[3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate has a molecular weight of 502.61 g/mol, XLogP of 6.13, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[methyl-[7-(9-oxoxanthen-3-yl)oxyheptyl]amino]methyl]phenyl] N-methylcarbamate is sourced from PubChem (CID 10896395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).