C22H29N3O3 — CID 108964258
N-[2-(2-methoxyphenyl)ethyl]-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide (PubChem CID 108964258) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108964258 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide |
| SMILES | COc1ccccc1CCNC(=O)C(C)(C)C(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,21(27)25(3)16-12-17-9-13-23-14-10-17)20(26)24-15-11-18-7-5-6-8-19(18)28-4/h5-10,13-14H,11-12,15-16H2,1-4H3,(H,24,26) |
| InChIKey | KFJKHDPAFWGHAQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|