C25H38O7SSi — CID 10896498
(4aR,8aR)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-8,8a-dihydro-3H-chromen-4-one (PubChem CID 10896498) has the molecular formula C25H38O7SSi and a molecular weight of 510.73 g/mol. Its IUPAC name is (4aR,8aR)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-8,8a-dihydro-3H-chromen-4-one.
| Compound Name | (4aR,8aR)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-8,8a-dihydro-3H-chromen-4-one |
|---|---|
| PubChem CID | 10896498 |
| Molecular Formula | C25H38O7SSi |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (4aR,8aR)-4a-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxy-2,2-dimethyl-8,8a-dihydro-3H-chromen-4-one |
| SMILES | COC1(OC)C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)CC(=O)[C@]21S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H38O7SSi/c1-22(2,3)34(8,9)32-18-15-21-25(24(16-18,29-6)30-7,20(26)17-23(4,5)31-21)33(27,28)19-13-11-10-12-14-19/h10-14,16,21H,15,17H2,1-9H3/t21-,25+/m1/s1 |
| InChIKey | POTFEWFEARNKGJ-BWKNWUBXSA-N |
| XLogP | 4.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|