C19H30N2O2 — CID 108966504
N-butyl-N,2,2-trimethyl-N'-(4-propan-2-ylphenyl)propanediamide (PubChem CID 108966504) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-butyl-N,2,2-trimethyl-N'-(4-propan-2-ylphenyl)propanediamide.
| Compound Name | N-butyl-N,2,2-trimethyl-N'-(4-propan-2-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 108966504 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-butyl-N,2,2-trimethyl-N'-(4-propan-2-ylphenyl)propanediamide |
| SMILES | CCCCN(C)C(=O)C(C)(C)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O2/c1-7-8-13-21(6)18(23)19(4,5)17(22)20-16-11-9-15(10-12-16)14(2)3/h9-12,14H,7-8,13H2,1-6H3,(H,20,22) |
| InChIKey | KBZQDXBAVSYDDQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|