C21H32N2O3 — CID 108966667
3-(2-ethylpiperidin-1-yl)-2,2-dimethyl-3-oxo-N-(4-propan-2-yloxyphenyl)propanamide (PubChem CID 108966667) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 3-(2-ethylpiperidin-1-yl)-2,2-dimethyl-3-oxo-N-(4-propan-2-yloxyphenyl)propanamide.
| Compound Name | 3-(2-ethylpiperidin-1-yl)-2,2-dimethyl-3-oxo-N-(4-propan-2-yloxyphenyl)propanamide |
|---|---|
| PubChem CID | 108966667 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 3-(2-ethylpiperidin-1-yl)-2,2-dimethyl-3-oxo-N-(4-propan-2-yloxyphenyl)propanamide |
| SMILES | CCC1CCCCN1C(=O)C(C)(C)C(=O)Nc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H32N2O3/c1-6-17-9-7-8-14-23(17)20(25)21(4,5)19(24)22-16-10-12-18(13-11-16)26-15(2)3/h10-13,15,17H,6-9,14H2,1-5H3,(H,22,24) |
| InChIKey | BIPWUFRRIGJQKI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|