C33H35NO5 — CID 10896680
(2R,3S,4R)-N-benzyl-4-hydroxy-2,3,5-tris(phenylmethoxy)pentan-1-imine oxide (PubChem CID 10896680) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is (2R,3S,4R)-N-benzyl-4-hydroxy-2,3,5-tris(phenylmethoxy)pentan-1-imine oxide.
| Compound Name | (2R,3S,4R)-N-benzyl-4-hydroxy-2,3,5-tris(phenylmethoxy)pentan-1-imine oxide |
|---|---|
| PubChem CID | 10896680 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (2R,3S,4R)-N-benzyl-4-hydroxy-2,3,5-tris(phenylmethoxy)pentan-1-imine oxide |
| SMILES | [O-]/[N+](=C\[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H35NO5/c35-31(26-37-23-28-15-7-2-8-16-28)33(39-25-30-19-11-4-12-20-30)32(38-24-29-17-9-3-10-18-29)22-34(36)21-27-13-5-1-6-14-27/h1-20,22,31-33,35H,21,23-26H2/b34-22-/t31-,32-,33+/m1/s1 |
| InChIKey | DRZUWGXLASKRAB-LIGIRDMPSA-N |
| XLogP | 5.52 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|