C34H44N2O4 — CID 10896876
2-cycloheptyl-4-[4-methoxy-3-(6-phenoxyhexoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 10896876) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2-cycloheptyl-4-[4-methoxy-3-(6-phenoxyhexoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-cycloheptyl-4-[4-methoxy-3-(6-phenoxyhexoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10896876 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 2-cycloheptyl-4-[4-methoxy-3-(6-phenoxyhexoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)C3CC=CCC23)cc1OCCCCCCOc1ccccc1 |
| InChI | InChI=1S/C34H44N2O4/c1-38-31-22-21-26(25-32(31)40-24-14-5-4-13-23-39-28-17-9-6-10-18-28)33-29-19-11-12-20-30(29)34(37)36(35-33)27-15-7-2-3-8-16-27/h6,9-12,17-18,21-22,25,27,29-30H,2-5,7-8,13-16,19-20,23-24H2,1H3 |
| InChIKey | LSQPGJAKGOVZCJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|