C18H54Si10 — CID 10896928
1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10-octadecamethylhexasilino[1,2-a]hexasiline (PubChem CID 10896928) has the molecular formula C18H54Si10 and a molecular weight of 551.49 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10-octadecamethylhexasilino[1,2-a]hexasiline.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10-octadecamethylhexasilino[1,2-a]hexasiline |
|---|---|
| PubChem CID | 10896928 |
| Molecular Formula | C18H54Si10 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10-octadecamethylhexasilino[1,2-a]hexasiline |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si]2(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]2(C)[Si]1(C)C |
| InChI | InChI=1S/C18H54Si10/c1-19(2)20(3,4)24(11,12)28(18)26(15,16)22(7,8)21(5,6)25(13,14)27(28,17)23(19,9)10/h1-18H3 |
| InChIKey | CEDATHSOVDNJQU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|