About trimethylsilanylium
trimethylsilanylium (PubChem CID 10897057) has the molecular formula C3H11Si+
and a molecular weight of 75.21 g/mol. Its IUPAC name is trimethylsilanylium.
Molecular Properties
| Compound Name | trimethylsilanylium |
| PubChem CID | 10897057 |
| Molecular Formula | C3H11Si+ |
| Molecular Weight | 75.21 g/mol |
| Exact Mass | 75.06 |
| IUPAC Name | trimethylsilanylium |
| SMILES | C[SiH2+](C)C |
| InChI | InChI=1S/C3H11Si/c1-4(2)3/h4H2,1-3H3/q+1 |
| InChIKey | REJMJPFTPXEVOG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilanylium?
The IUPAC name of trimethylsilanylium (CID 10897057) is trimethylsilanylium.
What is the SMILES notation for trimethylsilanylium?
The canonical SMILES for trimethylsilanylium is C[SiH2+](C)C.
What is the InChIKey of trimethylsilanylium?
The InChIKey is REJMJPFTPXEVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H11Si/c1-4(2)3/h4H2,1-3H3/q+1.
What are the key properties of trimethylsilanylium?
trimethylsilanylium has a molecular weight of 75.21 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilanylium is sourced from PubChem (CID 10897057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).