C37H35O2PS — CID 10897120
(1S,4R,6R,8R)-4-(2-dinaphthalen-1-ylphosphorylphenyl)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane (PubChem CID 10897120) has the molecular formula C37H35O2PS and a molecular weight of 574.73 g/mol. Its IUPAC name is (1S,4R,6R,8R)-4-(2-dinaphthalen-1-ylphosphorylphenyl)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane.
| Compound Name | (1S,4R,6R,8R)-4-(2-dinaphthalen-1-ylphosphorylphenyl)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane |
|---|---|
| PubChem CID | 10897120 |
| Molecular Formula | C37H35O2PS |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (1S,4R,6R,8R)-4-(2-dinaphthalen-1-ylphosphorylphenyl)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecane |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS[C@H](c1ccccc1P(=O)(c1cccc4ccccc14)c1cccc4ccccc14)O[C@@H]3C2 |
| InChI | InChI=1S/C37H35O2PS/c1-36(2)27-21-22-37(36)24-41-35(39-34(37)23-27)30-17-7-8-18-33(30)40(38,31-19-9-13-25-11-3-5-15-28(25)31)32-20-10-14-26-12-4-6-16-29(26)32/h3-20,27,34-35H,21-24H2,1-2H3/t27-,34-,35-,37-/m1/s1 |
| InChIKey | YJZIHURAKDCEPK-LXRASGKSSA-N |
| XLogP | 8.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|