About 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol
1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol (PubChem CID 10897165) has the molecular formula C25H32Br2N4O2
and a molecular weight of 580.37 g/mol. Its IUPAC name is 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol.
Molecular Properties
| Compound Name | 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol |
| PubChem CID | 10897165 |
| Molecular Formula | C25H32Br2N4O2 |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol |
| SMILES | OC(CN1CCN(CCN2CCOCC2)CC1)Cn1c2ccc(Br)cc2c2cc(Br)ccc21 |
| InChI | InChI=1S/C25H32Br2N4O2/c26-19-1-3-24-22(15-19)23-16-20(27)2-4-25(23)31(24)18-21(32)17-30-9-7-28(8-10-30)5-6-29-11-13-33-14-12-29/h1-4,15-16,21,32H,5-14,17-18H2 |
| InChIKey | MXTYFGDPQYBTCG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol?
The IUPAC name of 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol (CID 10897165) is 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol.
What is the SMILES notation for 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol?
The canonical SMILES for 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol is OC(CN1CCN(CCN2CCOCC2)CC1)Cn1c2ccc(Br)cc2c2cc(Br)ccc21.
What is the InChIKey of 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol?
The InChIKey is MXTYFGDPQYBTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32Br2N4O2/c26-19-1-3-24-22(15-19)23-16-20(27)2-4-25(23)31(24)18-21(32)17-30-9-7-28(8-10-30)5-6-29-11-13-33-14-12-29/h1-4,15-16,21,32H,5-14,17-18H2.
What are the key properties of 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol?
1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol has a molecular weight of 580.37 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dibromocarbazol-9-yl)-3-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]propan-2-ol is sourced from PubChem (CID 10897165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).