C35H44N2O4S — CID 10897222
N-(3,5-dimethylphenyl)-N-[(1S,2R,3S,4R)-4,7,7-trimethyl-3-[(5S,6R)-5-methyl-3-phenyloxazinan-6-yl]oxy-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide (PubChem CID 10897222) has the molecular formula C35H44N2O4S and a molecular weight of 588.81 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-[(1S,2R,3S,4R)-4,7,7-trimethyl-3-[(5S,6R)-5-methyl-3-phenyloxazinan-6-yl]oxy-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-[(1S,2R,3S,4R)-4,7,7-trimethyl-3-[(5S,6R)-5-methyl-3-phenyloxazinan-6-yl]oxy-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10897222 |
| Molecular Formula | C35H44N2O4S |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-[(1S,2R,3S,4R)-4,7,7-trimethyl-3-[(5S,6R)-5-methyl-3-phenyloxazinan-6-yl]oxy-2-bicyclo[2.2.1]heptanyl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(N([C@@H]2[C@H]3CC[C@@](C)([C@@H]2O[C@@H]2ONC(c4ccccc4)C[C@@H]2C)C3(C)C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C35H44N2O4S/c1-23-19-24(2)21-27(20-23)37(42(38,39)28-15-11-8-12-16-28)31-29-17-18-35(6,34(29,4)5)32(31)40-33-25(3)22-30(36-41-33)26-13-9-7-10-14-26/h7-16,19-21,25,29-33,36H,17-18,22H2,1-6H3/t25-,29+,30?,31+,32+,33+,35-/m0/s1 |
| InChIKey | WGFKVEGIHKLMNJ-IUTWYNLHSA-N |
| XLogP | 7.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |