C23H22Co2O12 — CID 10897345
[(2R,3S,6S)-3-acetyloxy-6-[(Z)-7-hydroxyhept-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate;carbon monoxide;cobalt (PubChem CID 10897345) has the molecular formula C23H22Co2O12 and a molecular weight of 608.28 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[(Z)-7-hydroxyhept-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate;carbon monoxide;cobalt.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[(Z)-7-hydroxyhept-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate;carbon monoxide;cobalt |
|---|---|
| PubChem CID | 10897345 |
| Molecular Formula | C23H22Co2O12 |
| Molecular Weight | 608.28 g/mol |
| Exact Mass | 607.98 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[(Z)-7-hydroxyhept-3-en-1-ynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate;carbon monoxide;cobalt |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#C/C=C\CCCO)C=C[C@@H]1OC(C)=O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C17H22O6.6CO.2Co/c1-13(19)21-12-17-16(22-14(2)20)10-9-15(23-17)8-6-4-3-5-7-11-18;6*1-2;;/h3-4,9-10,15-18H,5,7,11-12H2,1-2H3;;;;;;;;/b4-3-;;;;;;;;/t15-,16+,17-;;;;;;;;/m1......../s1 |
| InChIKey | ZRUJSCITPRAVGS-GWXGVFLVSA-N |
| XLogP | 0.91 |
| TPSA | 201.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|