C18H22N4O3 — CID 108973717
1-N'-(4-cyanophenyl)-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108973717) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-N'-(4-cyanophenyl)-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-cyanophenyl)-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973717 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-N'-(4-cyanophenyl)-1-N-(2-morpholin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2(C(=O)NCCN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c19-13-14-1-3-15(4-2-14)21-17(24)18(5-6-18)16(23)20-7-8-22-9-11-25-12-10-22/h1-4H,5-12H2,(H,20,23)(H,21,24) |
| InChIKey | VRJLRNDSULSYKG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|