C35H41BrN2OSi — CID 10897378
[5-[(5-bromo-1H-pyrrol-2-yl)-[4-(2-trimethylsilylethynyl)phenyl]methyl]-1H-pyrrol-2-yl]-(3,5-ditert-butylphenyl)methanone (PubChem CID 10897378) has the molecular formula C35H41BrN2OSi and a molecular weight of 613.72 g/mol. Its IUPAC name is [5-[(5-bromo-1H-pyrrol-2-yl)-[4-(2-trimethylsilylethynyl)phenyl]methyl]-1H-pyrrol-2-yl]-(3,5-ditert-butylphenyl)methanone.
| Compound Name | [5-[(5-bromo-1H-pyrrol-2-yl)-[4-(2-trimethylsilylethynyl)phenyl]methyl]-1H-pyrrol-2-yl]-(3,5-ditert-butylphenyl)methanone |
|---|---|
| PubChem CID | 10897378 |
| Molecular Formula | C35H41BrN2OSi |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [5-[(5-bromo-1H-pyrrol-2-yl)-[4-(2-trimethylsilylethynyl)phenyl]methyl]-1H-pyrrol-2-yl]-(3,5-ditert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1cc(C(=O)c2ccc(C(c3ccc(C#C[Si](C)(C)C)cc3)c3ccc(Br)[nH]3)[nH]2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H41BrN2OSi/c1-34(2,3)26-20-25(21-27(22-26)35(4,5)6)33(39)30-15-14-28(37-30)32(29-16-17-31(36)38-29)24-12-10-23(11-13-24)18-19-40(7,8)9/h10-17,20-22,32,37-38H,1-9H3 |
| InChIKey | LCZHPWWGAIVKME-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|