About Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+)
Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) (PubChem CID 10897454) has the molecular formula C18H12Br3N+
and a molecular weight of 482.01 g/mol.
Molecular Properties
| Compound Name | Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) |
| PubChem CID | 10897454 |
| Molecular Formula | C18H12Br3N+ |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 478.85 |
| IUPAC Name | — |
| SMILES | Brc1ccc([N+](c2ccc(Br)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H/q+1 |
| InChIKey | JMALIZSAHODQLH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 5.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+)?
The IUPAC name of Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) (CID 10897454) is not available.
What is the SMILES notation for Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+)?
The canonical SMILES for Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) is Brc1ccc([N+](c2ccc(Br)cc2)c2ccc(Br)cc2)cc1.
What is the InChIKey of Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+)?
The InChIKey is JMALIZSAHODQLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H/q+1.
What are the key properties of Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+)?
Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) has a molecular weight of 482.01 g/mol, XLogP of 7.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Benzenamine, 4-bromo-N,N-bis(4-bromophenyl)-, radical ion(1+) is sourced from PubChem (CID 10897454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).