C36H52N2O4Si2 — CID 10897496
5-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N,N-dibenzylpyridin-2-amine (PubChem CID 10897496) has the molecular formula C36H52N2O4Si2 and a molecular weight of 632.99 g/mol. Its IUPAC name is 5-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N,N-dibenzylpyridin-2-amine.
| Compound Name | 5-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N,N-dibenzylpyridin-2-amine |
|---|---|
| PubChem CID | 10897496 |
| Molecular Formula | C36H52N2O4Si2 |
| Molecular Weight | 632.99 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 5-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-N,N-dibenzylpyridin-2-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](c3ccc(N(Cc4ccccc4)Cc4ccccc4)nc3)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C36H52N2O4Si2/c1-26(2)43(27(3)4)39-25-35-34(41-44(42-43,28(5)6)29(7)8)21-33(40-35)32-19-20-36(37-22-32)38(23-30-15-11-9-12-16-30)24-31-17-13-10-14-18-31/h9-20,22,26-29,33-35H,21,23-25H2,1-8H3/t33-,34+,35-/m1/s1 |
| InChIKey | CPWAOPAQSVHVEK-GVBYMILNSA-N |
| XLogP | 9.07 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.99 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|