C38H46O5SSi — CID 10897549
(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,5-diol (PubChem CID 10897549) has the molecular formula C38H46O5SSi and a molecular weight of 642.93 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 10897549 |
| Molecular Formula | C38H46O5SSi |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxane-3,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@]1(C)O |
| InChI | InChI=1S/C38H46O5SSi/c1-36(2,3)45(5,6)43-34-33(39)35(44-31-25-17-10-18-26-31)42-32(37(34,4)40)27-41-38(28-19-11-7-12-20-28,29-21-13-8-14-22-29)30-23-15-9-16-24-30/h7-26,32-35,39-40H,27H2,1-6H3/t32-,33-,34-,35+,37-/m1/s1 |
| InChIKey | FEILIBJSFMROKS-YTCSVRQUSA-N |
| XLogP | 8.01 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|