C19H16F4N2O2 — CID 108975735
1-N-[(2-fluorophenyl)methyl]-1-N'-[3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108975735) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-N-[(2-fluorophenyl)methyl]-1-N'-[3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[(2-fluorophenyl)methyl]-1-N'-[3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108975735 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-N-[(2-fluorophenyl)methyl]-1-N'-[3-(trifluoromethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1ccccc1F)C1(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H16F4N2O2/c20-15-7-2-1-4-12(15)11-24-16(26)18(8-9-18)17(27)25-14-6-3-5-13(10-14)19(21,22)23/h1-7,10H,8-9,11H2,(H,24,26)(H,25,27) |
| InChIKey | SKXLZPDDHYFHCG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|